C13H20O3 — CID 177426996
(2E,4Z)-13-oxotrideca-2,4-dienoic acid (PubChem CID 177426996) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (2E,4Z)-13-oxotrideca-2,4-dienoic acid.
| Compound Name | (2E,4Z)-13-oxotrideca-2,4-dienoic acid |
|---|---|
| PubChem CID | 177426996 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (2E,4Z)-13-oxotrideca-2,4-dienoic acid |
| SMILES | O=CCCCCCCC/C=C\C=C\C(=O)O |
| InChI | InChI=1S/C13H20O3/c14-12-10-8-6-4-2-1-3-5-7-9-11-13(15)16/h5,7,9,11-12H,1-4,6,8,10H2,(H,15,16)/b7-5-,11-9+ |
| InChIKey | IDTWXYWXRFEWNM-BABZSUFTSA-N |
| XLogP | 3.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|