C26H36N6O7 — CID 20512019
2-[2-[2-[[4,6-bis[(E)-but-2-enoxy]-1,3,5-triazin-2-yl]oxy]ethoxy]ethoxy]-4,6-bis[(E)-but-2-enoxy]-1,3,5-triazine (PubChem CID 20512019) has the molecular formula C26H36N6O7 and a molecular weight of 544.61 g/mol. Its IUPAC name is 2-[2-[2-[[4,6-bis[(E)-but-2-enoxy]-1,3,5-triazin-2-yl]oxy]ethoxy]ethoxy]-4,6-bis[(E)-but-2-enoxy]-1,3,5-triazine.
| Compound Name | 2-[2-[2-[[4,6-bis[(E)-but-2-enoxy]-1,3,5-triazin-2-yl]oxy]ethoxy]ethoxy]-4,6-bis[(E)-but-2-enoxy]-1,3,5-triazine |
|---|---|
| PubChem CID | 20512019 |
| Molecular Formula | C26H36N6O7 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 2-[2-[2-[[4,6-bis[(E)-but-2-enoxy]-1,3,5-triazin-2-yl]oxy]ethoxy]ethoxy]-4,6-bis[(E)-but-2-enoxy]-1,3,5-triazine |
| SMILES | C/C=C/COc1nc(OC/C=C/C)nc(OCCOCCOc2nc(OC/C=C/C)nc(OC/C=C/C)n2)n1 |
| InChI | InChI=1S/C26H36N6O7/c1-5-9-13-34-21-27-22(35-14-10-6-2)30-25(29-21)38-19-17-33-18-20-39-26-31-23(36-15-11-7-3)28-24(32-26)37-16-12-8-4/h5-12H,13-20H2,1-4H3/b9-5+,10-6+,11-7+,12-8+ |
| InChIKey | HFJHMFHVMKFESV-HFBXSBKTSA-N |
| XLogP | 3.35 |
| TPSA | 141.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|