C9H16N4O3 — CID 80859204
4-ethoxy-6-(2-ethoxyethoxy)-1,3,5-triazin-2-amine (PubChem CID 80859204) has the molecular formula C9H16N4O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-ethoxy-6-(2-ethoxyethoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-ethoxy-6-(2-ethoxyethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80859204 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 4-ethoxy-6-(2-ethoxyethoxy)-1,3,5-triazin-2-amine |
| SMILES | CCOCCOc1nc(N)nc(OCC)n1 |
| InChI | InChI=1S/C9H16N4O3/c1-3-14-5-6-16-9-12-7(10)11-8(13-9)15-4-2/h3-6H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | UMTSVJSBYIEBAF-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 92.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|