C8H14N4O2S — CID 80884039
4-ethoxy-6-(2-methoxyethylsulfanyl)-1,3,5-triazin-2-amine (PubChem CID 80884039) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 4-ethoxy-6-(2-methoxyethylsulfanyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-ethoxy-6-(2-methoxyethylsulfanyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80884039 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 4-ethoxy-6-(2-methoxyethylsulfanyl)-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(N)nc(SCCOC)n1 |
| InChI | InChI=1S/C8H14N4O2S/c1-3-14-7-10-6(9)11-8(12-7)15-5-4-13-2/h3-5H2,1-2H3,(H2,9,10,11,12) |
| InChIKey | WJLBYWUMGRUULO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|