C7H10ClN3O2S — CID 62858857
2-chloro-4-methoxy-6-(2-methoxyethylsulfanyl)-1,3,5-triazine (PubChem CID 62858857) has the molecular formula C7H10ClN3O2S and a molecular weight of 235.70 g/mol. Its IUPAC name is 2-chloro-4-methoxy-6-(2-methoxyethylsulfanyl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-methoxy-6-(2-methoxyethylsulfanyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 62858857 |
| Molecular Formula | C7H10ClN3O2S |
| Molecular Weight | 235.70 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 2-chloro-4-methoxy-6-(2-methoxyethylsulfanyl)-1,3,5-triazine |
| SMILES | COCCSc1nc(Cl)nc(OC)n1 |
| InChI | InChI=1S/C7H10ClN3O2S/c1-12-3-4-14-7-10-5(8)9-6(11-7)13-2/h3-4H2,1-2H3 |
| InChIKey | BSDUTWHFPJAYSX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.70 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|