C12H22N4O3 — CID 106451498
4-[2-(2-methylpropoxy)ethoxy]-6-propoxy-1,3,5-triazin-2-amine (PubChem CID 106451498) has the molecular formula C12H22N4O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 4-[2-(2-methylpropoxy)ethoxy]-6-propoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-[2-(2-methylpropoxy)ethoxy]-6-propoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106451498 |
| Molecular Formula | C12H22N4O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 4-[2-(2-methylpropoxy)ethoxy]-6-propoxy-1,3,5-triazin-2-amine |
| SMILES | CCCOc1nc(N)nc(OCCOCC(C)C)n1 |
| InChI | InChI=1S/C12H22N4O3/c1-4-5-18-11-14-10(13)15-12(16-11)19-7-6-17-8-9(2)3/h9H,4-8H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | HDWSFUQLAFXQGV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 92.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|