C11H20N4O3 — CID 106451460
4-methoxy-N-methyl-6-[2-(2-methylpropoxy)ethoxy]-1,3,5-triazin-2-amine (PubChem CID 106451460) has the molecular formula C11H20N4O3 and a molecular weight of 256.31 g/mol. Its IUPAC name is 4-methoxy-N-methyl-6-[2-(2-methylpropoxy)ethoxy]-1,3,5-triazin-2-amine.
| Compound Name | 4-methoxy-N-methyl-6-[2-(2-methylpropoxy)ethoxy]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106451460 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 4-methoxy-N-methyl-6-[2-(2-methylpropoxy)ethoxy]-1,3,5-triazin-2-amine |
| SMILES | CNc1nc(OC)nc(OCCOCC(C)C)n1 |
| InChI | InChI=1S/C11H20N4O3/c1-8(2)7-17-5-6-18-11-14-9(12-3)13-10(15-11)16-4/h8H,5-7H2,1-4H3,(H,12,13,14,15) |
| InChIKey | CBRYLDYHVHJNAZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|