C12H23N5O3 — CID 106451582
[4-[2-(2-methylpropoxy)ethoxy]-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 106451582) has the molecular formula C12H23N5O3 and a molecular weight of 285.35 g/mol. Its IUPAC name is [4-[2-(2-methylpropoxy)ethoxy]-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-[2-(2-methylpropoxy)ethoxy]-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 106451582 |
| Molecular Formula | C12H23N5O3 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | [4-[2-(2-methylpropoxy)ethoxy]-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CC(C)COCCOc1nc(NN)nc(OC(C)C)n1 |
| InChI | InChI=1S/C12H23N5O3/c1-8(2)7-18-5-6-19-11-14-10(17-13)15-12(16-11)20-9(3)4/h8-9H,5-7,13H2,1-4H3,(H,14,15,16,17) |
| InChIKey | PDQXSLRXTKZJMC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|