C12H23N5O2 — CID 80923879
[4-(3,3-dimethylbutoxy)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80923879) has the molecular formula C12H23N5O2 and a molecular weight of 269.35 g/mol. Its IUPAC name is [4-(3,3-dimethylbutoxy)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(3,3-dimethylbutoxy)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80923879 |
| Molecular Formula | C12H23N5O2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | [4-(3,3-dimethylbutoxy)-6-propan-2-yloxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CC(C)Oc1nc(NN)nc(OCCC(C)(C)C)n1 |
| InChI | InChI=1S/C12H23N5O2/c1-8(2)19-11-15-9(17-13)14-10(16-11)18-7-6-12(3,4)5/h8H,6-7,13H2,1-5H3,(H,14,15,16,17) |
| InChIKey | YNBATJDQVPPVSO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|