C9H16N4O3 — CID 80866297
4-methoxy-6-(3-methoxypropoxy)-N-methyl-1,3,5-triazin-2-amine (PubChem CID 80866297) has the molecular formula C9H16N4O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-methoxy-6-(3-methoxypropoxy)-N-methyl-1,3,5-triazin-2-amine.
| Compound Name | 4-methoxy-6-(3-methoxypropoxy)-N-methyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80866297 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 4-methoxy-6-(3-methoxypropoxy)-N-methyl-1,3,5-triazin-2-amine |
| SMILES | CNc1nc(OC)nc(OCCCOC)n1 |
| InChI | InChI=1S/C9H16N4O3/c1-10-7-11-8(15-3)13-9(12-7)16-6-4-5-14-2/h4-6H2,1-3H3,(H,10,11,12,13) |
| InChIKey | MRILUVPADPFKGQ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|