C14H18N4O3 — CID 80867250
4-methoxy-N-methyl-6-(2-propoxyphenoxy)-1,3,5-triazin-2-amine (PubChem CID 80867250) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-methoxy-N-methyl-6-(2-propoxyphenoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-methoxy-N-methyl-6-(2-propoxyphenoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80867250 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 4-methoxy-N-methyl-6-(2-propoxyphenoxy)-1,3,5-triazin-2-amine |
| SMILES | CCCOc1ccccc1Oc1nc(NC)nc(OC)n1 |
| InChI | InChI=1S/C14H18N4O3/c1-4-9-20-10-7-5-6-8-11(10)21-14-17-12(15-2)16-13(18-14)19-3/h5-8H,4,9H2,1-3H3,(H,15,16,17,18) |
| InChIKey | XUHXVDRRMBQYMZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |