C15H20N4O2 — CID 104663162
N-ethyl-4-methoxy-6-(2-propoxyphenyl)-1,3,5-triazin-2-amine (PubChem CID 104663162) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-ethyl-4-methoxy-6-(2-propoxyphenyl)-1,3,5-triazin-2-amine.
| Compound Name | N-ethyl-4-methoxy-6-(2-propoxyphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 104663162 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-ethyl-4-methoxy-6-(2-propoxyphenyl)-1,3,5-triazin-2-amine |
| SMILES | CCCOc1ccccc1-c1nc(NCC)nc(OC)n1 |
| InChI | InChI=1S/C15H20N4O2/c1-4-10-21-12-9-7-6-8-11(12)13-17-14(16-5-2)19-15(18-13)20-3/h6-9H,4-5,10H2,1-3H3,(H,16,17,18,19) |
| InChIKey | WKFNVAXDAWZNCY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |