C10H14N4O2 — CID 106795654
4-but-3-ynoxy-6-propoxy-1,3,5-triazin-2-amine (PubChem CID 106795654) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 4-but-3-ynoxy-6-propoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-but-3-ynoxy-6-propoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106795654 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 4-but-3-ynoxy-6-propoxy-1,3,5-triazin-2-amine |
| SMILES | C#CCCOc1nc(N)nc(OCCC)n1 |
| InChI | InChI=1S/C10H14N4O2/c1-3-5-7-16-10-13-8(11)12-9(14-10)15-6-4-2/h1H,4-7H2,2H3,(H2,11,12,13,14) |
| InChIKey | WNCVEXWGNUZSEW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|