C12H16N4O2S — CID 80873586
4-propoxy-6-(2-thiophen-2-ylethoxy)-1,3,5-triazin-2-amine (PubChem CID 80873586) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-propoxy-6-(2-thiophen-2-ylethoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-propoxy-6-(2-thiophen-2-ylethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80873586 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-propoxy-6-(2-thiophen-2-ylethoxy)-1,3,5-triazin-2-amine |
| SMILES | CCCOc1nc(N)nc(OCCc2cccs2)n1 |
| InChI | InChI=1S/C12H16N4O2S/c1-2-6-17-11-14-10(13)15-12(16-11)18-7-5-9-4-3-8-19-9/h3-4,8H,2,5-7H2,1H3,(H2,13,14,15,16) |
| InChIKey | KSOGRVTWNPPFGJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |