C9H12ClN3O2 — CID 76950863
2-but-2-enoxy-4-chloro-6-ethoxy-1,3,5-triazine (PubChem CID 76950863) has the molecular formula C9H12ClN3O2 and a molecular weight of 229.67 g/mol. Its IUPAC name is 2-but-2-enoxy-4-chloro-6-ethoxy-1,3,5-triazine.
| Compound Name | 2-but-2-enoxy-4-chloro-6-ethoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 76950863 |
| Molecular Formula | C9H12ClN3O2 |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 2-but-2-enoxy-4-chloro-6-ethoxy-1,3,5-triazine |
| SMILES | CC=CCOc1nc(Cl)nc(OCC)n1 |
| InChI | InChI=1S/C9H12ClN3O2/c1-3-5-6-15-9-12-7(10)11-8(13-9)14-4-2/h3,5H,4,6H2,1-2H3 |
| InChIKey | LPLDVGJRCNFOCG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|