C8H8Cl2N2O — CID 130569651
4-[(E)-but-2-enoxy]-2,6-dichloropyrimidine (PubChem CID 130569651) has the molecular formula C8H8Cl2N2O and a molecular weight of 219.07 g/mol. Its IUPAC name is 4-[(E)-but-2-enoxy]-2,6-dichloropyrimidine.
| Compound Name | 4-[(E)-but-2-enoxy]-2,6-dichloropyrimidine |
|---|---|
| PubChem CID | 130569651 |
| Molecular Formula | C8H8Cl2N2O |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 4-[(E)-but-2-enoxy]-2,6-dichloropyrimidine |
| SMILES | C/C=C/COc1cc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C8H8Cl2N2O/c1-2-3-4-13-7-5-6(9)11-8(10)12-7/h2-3,5H,4H2,1H3/b3-2+ |
| InChIKey | SACBQUCCPXTDAD-NSCUHMNNSA-N |
| XLogP | 2.74 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|