C12H19N3O — CID 80941264
6-[(E)-but-2-enoxy]-N,2-diethylpyrimidin-4-amine (PubChem CID 80941264) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 6-[(E)-but-2-enoxy]-N,2-diethylpyrimidin-4-amine.
| Compound Name | 6-[(E)-but-2-enoxy]-N,2-diethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80941264 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 6-[(E)-but-2-enoxy]-N,2-diethylpyrimidin-4-amine |
| SMILES | C/C=C/COc1cc(NCC)nc(CC)n1 |
| InChI | InChI=1S/C12H19N3O/c1-4-7-8-16-12-9-11(13-6-3)14-10(5-2)15-12/h4,7,9H,5-6,8H2,1-3H3,(H,13,14,15)/b7-4+ |
| InChIKey | UYRWUXJNILVTJA-QPJJXVBHSA-N |
| XLogP | 2.43 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|