C11H16F3N3O — CID 80942175
N,2-diethyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-4-amine (PubChem CID 80942175) has the molecular formula C11H16F3N3O and a molecular weight of 263.26 g/mol. Its IUPAC name is N,2-diethyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-4-amine.
| Compound Name | N,2-diethyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80942175 |
| Molecular Formula | C11H16F3N3O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | N,2-diethyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-4-amine |
| SMILES | CCNc1cc(OC(C)C(F)(F)F)nc(CC)n1 |
| InChI | InChI=1S/C11H16F3N3O/c1-4-8-16-9(15-5-2)6-10(17-8)18-7(3)11(12,13)14/h6-7H,4-5H2,1-3H3,(H,15,16,17) |
| InChIKey | WVXJRPKIVKOGSU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |