C9H10F6N4O — CID 102723665
4-N-ethyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pyrimidine-2,4-diamine (PubChem CID 102723665) has the molecular formula C9H10F6N4O and a molecular weight of 304.19 g/mol. Its IUPAC name is 4-N-ethyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pyrimidine-2,4-diamine.
| Compound Name | 4-N-ethyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 102723665 |
| Molecular Formula | C9H10F6N4O |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-N-ethyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pyrimidine-2,4-diamine |
| SMILES | CCNc1cc(OC(C(F)(F)F)C(F)(F)F)nc(N)n1 |
| InChI | InChI=1S/C9H10F6N4O/c1-2-17-4-3-5(19-7(16)18-4)20-6(8(10,11)12)9(13,14)15/h3,6H,2H2,1H3,(H3,16,17,18,19) |
| InChIKey | GQKRDARXXVBLNR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |