C14H25N3O — CID 80942333
N,2-diethyl-6-(4-methylpentan-2-yloxy)pyrimidin-4-amine (PubChem CID 80942333) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is N,2-diethyl-6-(4-methylpentan-2-yloxy)pyrimidin-4-amine.
| Compound Name | N,2-diethyl-6-(4-methylpentan-2-yloxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80942333 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | N,2-diethyl-6-(4-methylpentan-2-yloxy)pyrimidin-4-amine |
| SMILES | CCNc1cc(OC(C)CC(C)C)nc(CC)n1 |
| InChI | InChI=1S/C14H25N3O/c1-6-12-16-13(15-7-2)9-14(17-12)18-11(5)8-10(3)4/h9-11H,6-8H2,1-5H3,(H,15,16,17) |
| InChIKey | OYKDKVCPPTYLIN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |