C7H8ClNOS — CID 83152624
2-[(E)-but-2-enoxy]-4-chloro-1,3-thiazole (PubChem CID 83152624) has the molecular formula C7H8ClNOS and a molecular weight of 189.67 g/mol. Its IUPAC name is 2-[(E)-but-2-enoxy]-4-chloro-1,3-thiazole.
| Compound Name | 2-[(E)-but-2-enoxy]-4-chloro-1,3-thiazole |
|---|---|
| PubChem CID | 83152624 |
| Molecular Formula | C7H8ClNOS |
| Molecular Weight | 189.67 g/mol |
| Exact Mass | 189.00 |
| IUPAC Name | 2-[(E)-but-2-enoxy]-4-chloro-1,3-thiazole |
| SMILES | C/C=C/COc1nc(Cl)cs1 |
| InChI | InChI=1S/C7H8ClNOS/c1-2-3-4-10-7-9-6(8)5-11-7/h2-3,5H,4H2,1H3/b3-2+ |
| InChIKey | RNPASPZHDDCWPR-NSCUHMNNSA-N |
| XLogP | 2.75 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.67 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|