C8H12ClNO2S — CID 83152492
4-chloro-2-(2-propan-2-yloxyethoxy)-1,3-thiazole (PubChem CID 83152492) has the molecular formula C8H12ClNO2S and a molecular weight of 221.71 g/mol. Its IUPAC name is 4-chloro-2-(2-propan-2-yloxyethoxy)-1,3-thiazole.
| Compound Name | 4-chloro-2-(2-propan-2-yloxyethoxy)-1,3-thiazole |
|---|---|
| PubChem CID | 83152492 |
| Molecular Formula | C8H12ClNO2S |
| Molecular Weight | 221.71 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 4-chloro-2-(2-propan-2-yloxyethoxy)-1,3-thiazole |
| SMILES | CC(C)OCCOc1nc(Cl)cs1 |
| InChI | InChI=1S/C8H12ClNO2S/c1-6(2)11-3-4-12-8-10-7(9)5-13-8/h5-6H,3-4H2,1-2H3 |
| InChIKey | FEYNIMSMTIOBAE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.71 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|