C9H14BrNO2S — CID 106447494
4-bromo-2-[2-(2-methylpropoxy)ethoxy]-1,3-thiazole (PubChem CID 106447494) has the molecular formula C9H14BrNO2S and a molecular weight of 280.19 g/mol. Its IUPAC name is 4-bromo-2-[2-(2-methylpropoxy)ethoxy]-1,3-thiazole.
| Compound Name | 4-bromo-2-[2-(2-methylpropoxy)ethoxy]-1,3-thiazole |
|---|---|
| PubChem CID | 106447494 |
| Molecular Formula | C9H14BrNO2S |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 4-bromo-2-[2-(2-methylpropoxy)ethoxy]-1,3-thiazole |
| SMILES | CC(C)COCCOc1nc(Br)cs1 |
| InChI | InChI=1S/C9H14BrNO2S/c1-7(2)5-12-3-4-13-9-11-8(10)6-14-9/h6-7H,3-5H2,1-2H3 |
| InChIKey | PRHCTEGXEAAHSU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|