C11H17BrO2S — CID 106448565
3-bromo-2-[2-(2-methylpropoxy)ethoxymethyl]thiophene (PubChem CID 106448565) has the molecular formula C11H17BrO2S and a molecular weight of 293.23 g/mol. Its IUPAC name is 3-bromo-2-[2-(2-methylpropoxy)ethoxymethyl]thiophene.
| Compound Name | 3-bromo-2-[2-(2-methylpropoxy)ethoxymethyl]thiophene |
|---|---|
| PubChem CID | 106448565 |
| Molecular Formula | C11H17BrO2S |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 3-bromo-2-[2-(2-methylpropoxy)ethoxymethyl]thiophene |
| SMILES | CC(C)COCCOCc1sccc1Br |
| InChI | InChI=1S/C11H17BrO2S/c1-9(2)7-13-4-5-14-8-11-10(12)3-6-15-11/h3,6,9H,4-5,7-8H2,1-2H3 |
| InChIKey | ZNUZFXFAEVMZAE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|