C10H13Cl3N2O2 — CID 139609491
3,4,6-trichloro-5-[2-(2-methylpropoxy)ethoxy]pyridazine (PubChem CID 139609491) has the molecular formula C10H13Cl3N2O2 and a molecular weight of 299.59 g/mol. Its IUPAC name is 3,4,6-trichloro-5-[2-(2-methylpropoxy)ethoxy]pyridazine.
| Compound Name | 3,4,6-trichloro-5-[2-(2-methylpropoxy)ethoxy]pyridazine |
|---|---|
| PubChem CID | 139609491 |
| Molecular Formula | C10H13Cl3N2O2 |
| Molecular Weight | 299.59 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 3,4,6-trichloro-5-[2-(2-methylpropoxy)ethoxy]pyridazine |
| SMILES | CC(C)COCCOc1c(Cl)nnc(Cl)c1Cl |
| InChI | InChI=1S/C10H13Cl3N2O2/c1-6(2)5-16-3-4-17-8-7(11)9(12)14-15-10(8)13/h6H,3-5H2,1-2H3 |
| InChIKey | IUDBZVNLWINMFB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|