C12H17Cl2NO2 — CID 106448479
3-chloro-5-(chloromethyl)-2-[2-(2-methylpropoxy)ethoxy]pyridine (PubChem CID 106448479) has the molecular formula C12H17Cl2NO2 and a molecular weight of 278.18 g/mol. Its IUPAC name is 3-chloro-5-(chloromethyl)-2-[2-(2-methylpropoxy)ethoxy]pyridine.
| Compound Name | 3-chloro-5-(chloromethyl)-2-[2-(2-methylpropoxy)ethoxy]pyridine |
|---|---|
| PubChem CID | 106448479 |
| Molecular Formula | C12H17Cl2NO2 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 3-chloro-5-(chloromethyl)-2-[2-(2-methylpropoxy)ethoxy]pyridine |
| SMILES | CC(C)COCCOc1ncc(CCl)cc1Cl |
| InChI | InChI=1S/C12H17Cl2NO2/c1-9(2)8-16-3-4-17-12-11(14)5-10(6-13)7-15-12/h5,7,9H,3-4,6,8H2,1-2H3 |
| InChIKey | IZRWUMOMOGHDOP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|