C12H19ClN2O3 — CID 103405668
[5-chloro-6-[3-(2-methoxyethoxy)propoxy]-3-pyridinyl]methanamine (PubChem CID 103405668) has the molecular formula C12H19ClN2O3 and a molecular weight of 274.75 g/mol. Its IUPAC name is [5-chloro-6-[3-(2-methoxyethoxy)propoxy]-3-pyridinyl]methanamine.
| Compound Name | [5-chloro-6-[3-(2-methoxyethoxy)propoxy]-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 103405668 |
| Molecular Formula | C12H19ClN2O3 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | [5-chloro-6-[3-(2-methoxyethoxy)propoxy]-3-pyridinyl]methanamine |
| SMILES | COCCOCCCOc1ncc(CN)cc1Cl |
| InChI | InChI=1S/C12H19ClN2O3/c1-16-5-6-17-3-2-4-18-12-11(13)7-10(8-14)9-15-12/h7,9H,2-6,8,14H2,1H3 |
| InChIKey | ILPSQMHYJOWPRQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|