C8H12ClNOS — CID 83152735
4-chloro-2-pentoxy-1,3-thiazole (PubChem CID 83152735) has the molecular formula C8H12ClNOS and a molecular weight of 205.71 g/mol. Its IUPAC name is 4-chloro-2-pentoxy-1,3-thiazole.
| Compound Name | 4-chloro-2-pentoxy-1,3-thiazole |
|---|---|
| PubChem CID | 83152735 |
| Molecular Formula | C8H12ClNOS |
| Molecular Weight | 205.71 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 4-chloro-2-pentoxy-1,3-thiazole |
| SMILES | CCCCCOc1nc(Cl)cs1 |
| InChI | InChI=1S/C8H12ClNOS/c1-2-3-4-5-11-8-10-7(9)6-12-8/h6H,2-5H2,1H3 |
| InChIKey | GSSRATSYHSTVJZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.71 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|