C9H15ClN4O2 — CID 80859965
4-chloro-N-methyl-6-(2-propan-2-yloxyethoxy)-1,3,5-triazin-2-amine (PubChem CID 80859965) has the molecular formula C9H15ClN4O2 and a molecular weight of 246.70 g/mol. Its IUPAC name is 4-chloro-N-methyl-6-(2-propan-2-yloxyethoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-methyl-6-(2-propan-2-yloxyethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80859965 |
| Molecular Formula | C9H15ClN4O2 |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-chloro-N-methyl-6-(2-propan-2-yloxyethoxy)-1,3,5-triazin-2-amine |
| SMILES | CNc1nc(Cl)nc(OCCOC(C)C)n1 |
| InChI | InChI=1S/C9H15ClN4O2/c1-6(2)15-4-5-16-9-13-7(10)12-8(11-3)14-9/h6H,4-5H2,1-3H3,(H,11,12,13,14) |
| InChIKey | TZTCHOYMUGKWTN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|