C11H16FNO2 — CID 146388908
2-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-N-methoxy-N-methylacetamide (PubChem CID 146388908) has the molecular formula C11H16FNO2 and a molecular weight of 213.25 g/mol. Its IUPAC name is 2-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-N-methoxy-N-methylacetamide.
| Compound Name | 2-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 146388908 |
| Molecular Formula | C11H16FNO2 |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 2-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-N-methoxy-N-methylacetamide |
| SMILES | CON(C)C(=O)CC1=CC=C(F)CC1C |
| InChI | InChI=1S/C11H16FNO2/c1-8-6-10(12)5-4-9(8)7-11(14)13(2)15-3/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | MXEDMGVTFIKEAE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|