About (4-ethyl-2,6-dimethylcyclohex-3-en-1-yl)methanol
(4-ethyl-2,6-dimethylcyclohex-3-en-1-yl)methanol (PubChem CID 89004722) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is (4-ethyl-2,6-dimethylcyclohex-3-en-1-yl)methanol.
Molecular Properties
| Compound Name | (4-ethyl-2,6-dimethylcyclohex-3-en-1-yl)methanol |
| PubChem CID | 89004722 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (4-ethyl-2,6-dimethylcyclohex-3-en-1-yl)methanol |
| SMILES | CCC1=CC(C)C(CO)C(C)C1 |
| InChI | InChI=1S/C11H20O/c1-4-10-5-8(2)11(7-12)9(3)6-10/h5,8-9,11-12H,4,6-7H2,1-3H3 |
| InChIKey | QGZKPUQXJQBYQU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-ethyl-2,6-dimethylcyclohex-3-en-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethyl-2,6-dimethylcyclohex-3-en-1-yl)methanol?
The IUPAC name of (4-ethyl-2,6-dimethylcyclohex-3-en-1-yl)methanol (CID 89004722) is (4-ethyl-2,6-dimethylcyclohex-3-en-1-yl)methanol.
What is the SMILES notation for (4-ethyl-2,6-dimethylcyclohex-3-en-1-yl)methanol?
The canonical SMILES for (4-ethyl-2,6-dimethylcyclohex-3-en-1-yl)methanol is CCC1=CC(C)C(CO)C(C)C1.
What is the InChIKey of (4-ethyl-2,6-dimethylcyclohex-3-en-1-yl)methanol?
The InChIKey is QGZKPUQXJQBYQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O/c1-4-10-5-8(2)11(7-12)9(3)6-10/h5,8-9,11-12H,4,6-7H2,1-3H3.
What are the key properties of (4-ethyl-2,6-dimethylcyclohex-3-en-1-yl)methanol?
(4-ethyl-2,6-dimethylcyclohex-3-en-1-yl)methanol has a molecular weight of 168.28 g/mol, XLogP of 2.61, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethyl-2,6-dimethylcyclohex-3-en-1-yl)methanol is sourced from PubChem (CID 89004722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).