C11H21N — CID 123458778
2,6-dimethyl-4-propylcyclohex-3-en-1-amine (PubChem CID 123458778) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is 2,6-dimethyl-4-propylcyclohex-3-en-1-amine.
| Compound Name | 2,6-dimethyl-4-propylcyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 123458778 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 2,6-dimethyl-4-propylcyclohex-3-en-1-amine |
| SMILES | CCCC1=CC(C)C(N)C(C)C1 |
| InChI | InChI=1S/C11H21N/c1-4-5-10-6-8(2)11(12)9(3)7-10/h6,8-9,11H,4-5,7,12H2,1-3H3 |
| InChIKey | POWCEOPLIIWJPE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|