C17H32 — CID 59036734
4,5-ditert-butyl-1-propylcyclohexene (PubChem CID 59036734) has the molecular formula C17H32 and a molecular weight of 236.44 g/mol. Its IUPAC name is 4,5-ditert-butyl-1-propylcyclohexene.
| Compound Name | 4,5-ditert-butyl-1-propylcyclohexene |
|---|---|
| PubChem CID | 59036734 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | 4,5-ditert-butyl-1-propylcyclohexene |
| SMILES | CCCC1=CCC(C(C)(C)C)C(C(C)(C)C)C1 |
| InChI | InChI=1S/C17H32/c1-8-9-13-10-11-14(16(2,3)4)15(12-13)17(5,6)7/h10,14-15H,8-9,11-12H2,1-7H3 |
| InChIKey | GQVMLZLCWIAAOQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|