C20H24O2 — CID 175852792
6-methyl-2-pentyl-1,4,4a,9a-tetrahydroanthracene-9,10-dione (PubChem CID 175852792) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 6-methyl-2-pentyl-1,4,4a,9a-tetrahydroanthracene-9,10-dione.
| Compound Name | 6-methyl-2-pentyl-1,4,4a,9a-tetrahydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 175852792 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 6-methyl-2-pentyl-1,4,4a,9a-tetrahydroanthracene-9,10-dione |
| SMILES | CCCCCC1=CCC2C(=O)c3cc(C)ccc3C(=O)C2C1 |
| InChI | InChI=1S/C20H24O2/c1-3-4-5-6-14-8-10-16-18(12-14)20(22)15-9-7-13(2)11-17(15)19(16)21/h7-9,11,16,18H,3-6,10,12H2,1-2H3 |
| InChIKey | MVTAIXJZTPHRSI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|