C10H8NO3Y- — CID 171799012
formaldehyde;5-methylisoindol-2-ide-1,3-dione;yttrium (PubChem CID 171799012) has the molecular formula C10H8NO3Y- and a molecular weight of 279.08 g/mol. Its IUPAC name is formaldehyde;5-methylisoindol-2-ide-1,3-dione;yttrium.
| Compound Name | formaldehyde;5-methylisoindol-2-ide-1,3-dione;yttrium |
|---|---|
| PubChem CID | 171799012 |
| Molecular Formula | C10H8NO3Y- |
| Molecular Weight | 279.08 g/mol |
| Exact Mass | 278.96 |
| IUPAC Name | formaldehyde;5-methylisoindol-2-ide-1,3-dione;yttrium |
| SMILES | C=O.Cc1ccc2c(c1)C(=O)[N-]C2=O.[Y] |
| InChI | InChI=1S/C9H7NO2.CH2O.Y/c1-5-2-3-6-7(4-5)9(12)10-8(6)11;1-2;/h2-4H,1H3,(H,10,11,12);1H2;/p-1 |
| InChIKey | VCZQCCRJPIYFAH-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 65.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.08 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|