About 5-methylisoindole-1,3-dione;propane
5-methylisoindole-1,3-dione;propane (PubChem CID 156794481) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 5-methylisoindole-1,3-dione;propane.
Molecular Properties
| Compound Name | 5-methylisoindole-1,3-dione;propane |
| PubChem CID | 156794481 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 5-methylisoindole-1,3-dione;propane |
| SMILES | CCC.Cc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C9H7NO2.C3H8/c1-5-2-3-6-7(4-5)9(12)10-8(6)11;1-3-2/h2-4H,1H3,(H,10,11,12);3H2,1-2H3 |
| InChIKey | XYGZOHHQJYOQJD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-methylisoindole-1,3-dione;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylisoindole-1,3-dione;propane?
The IUPAC name of 5-methylisoindole-1,3-dione;propane (CID 156794481) is 5-methylisoindole-1,3-dione;propane.
What is the SMILES notation for 5-methylisoindole-1,3-dione;propane?
The canonical SMILES for 5-methylisoindole-1,3-dione;propane is CCC.Cc1ccc2c(c1)C(=O)NC2=O.
What is the InChIKey of 5-methylisoindole-1,3-dione;propane?
The InChIKey is XYGZOHHQJYOQJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2.C3H8/c1-5-2-3-6-7(4-5)9(12)10-8(6)11;1-3-2/h2-4H,1H3,(H,10,11,12);3H2,1-2H3.
What are the key properties of 5-methylisoindole-1,3-dione;propane?
5-methylisoindole-1,3-dione;propane has a molecular weight of 205.26 g/mol, XLogP of 2.29, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylisoindole-1,3-dione;propane is sourced from PubChem (CID 156794481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).