C12H15NO2 — CID 156794481
5-methylisoindole-1,3-dione;propane (PubChem CID 156794481) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 5-methylisoindole-1,3-dione;propane.
| Compound Name | 5-methylisoindole-1,3-dione;propane |
|---|---|
| PubChem CID | 156794481 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 5-methylisoindole-1,3-dione;propane |
| SMILES | CCC.Cc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C9H7NO2.C3H8/c1-5-2-3-6-7(4-5)9(12)10-8(6)11;1-3-2/h2-4H,1H3,(H,10,11,12);3H2,1-2H3 |
| InChIKey | XYGZOHHQJYOQJD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|