C17H10N2O4 — CID 834245
5-[(1,3-dioxoisoindol-5-yl)methyl]isoindole-1,3-dione (PubChem CID 834245) has the molecular formula C17H10N2O4 and a molecular weight of 306.28 g/mol. Its IUPAC name is 5-[(1,3-dioxoisoindol-5-yl)methyl]isoindole-1,3-dione.
| Compound Name | 5-[(1,3-dioxoisoindol-5-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 834245 |
| Molecular Formula | C17H10N2O4 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 5-[(1,3-dioxoisoindol-5-yl)methyl]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(Cc3ccc4c(c3)C(=O)NC4=O)ccc21 |
| InChI | InChI=1S/C17H10N2O4/c20-14-10-3-1-8(6-12(10)16(22)18-14)5-9-2-4-11-13(7-9)17(23)19-15(11)21/h1-4,6-7H,5H2,(H,18,20,22)(H,19,21,23) |
| InChIKey | RMQKJHRJCCUUJN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|