C10H17NO — CID 142996241
1-[(2S)-4-propyl-1,2,3,6-tetrahydropyridin-2-yl]ethanone (PubChem CID 142996241) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-[(2S)-4-propyl-1,2,3,6-tetrahydropyridin-2-yl]ethanone.
| Compound Name | 1-[(2S)-4-propyl-1,2,3,6-tetrahydropyridin-2-yl]ethanone |
|---|---|
| PubChem CID | 142996241 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-[(2S)-4-propyl-1,2,3,6-tetrahydropyridin-2-yl]ethanone |
| SMILES | CCCC1=CCN[C@H](C(C)=O)C1 |
| InChI | InChI=1S/C10H17NO/c1-3-4-9-5-6-11-10(7-9)8(2)12/h5,10-11H,3-4,6-7H2,1-2H3/t10-/m0/s1 |
| InChIKey | CEZYCMWIUUCKAL-JTQLQIEISA-N |
| XLogP | 1.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|