About (5S)-5-[bis(3,5-dipropylphenyl)-hydroxymethyl]pyrrolidin-2-one
(5S)-5-[bis(3,5-dipropylphenyl)-hydroxymethyl]pyrrolidin-2-one (PubChem CID 24815206) has the molecular formula C29H41NO2
and a molecular weight of 435.65 g/mol. Its IUPAC name is (5S)-5-[bis(3,5-dipropylphenyl)-hydroxymethyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | (5S)-5-[bis(3,5-dipropylphenyl)-hydroxymethyl]pyrrolidin-2-one |
| PubChem CID | 24815206 |
| Molecular Formula | C29H41NO2 |
| Molecular Weight | 435.65 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | (5S)-5-[bis(3,5-dipropylphenyl)-hydroxymethyl]pyrrolidin-2-one |
| SMILES | CCCc1cc(CCC)cc(C(O)(c2cc(CCC)cc(CCC)c2)[C@@H]2CCC(=O)N2)c1 |
| InChI | InChI=1S/C29H41NO2/c1-5-9-21-15-22(10-6-2)18-25(17-21)29(32,27-13-14-28(31)30-27)26-19-23(11-7-3)16-24(20-26)12-8-4/h15-20,27,32H,5-14H2,1-4H3,(H,30,31)/t27-/m0/s1 |
| InChIKey | YNAQEZUNHSHNHA-MHZLTWQESA-N |
| XLogP | 6.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-5-[bis(3,5-dipropylphenyl)-hydroxymethyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-[bis(3,5-dipropylphenyl)-hydroxymethyl]pyrrolidin-2-one?
The IUPAC name of (5S)-5-[bis(3,5-dipropylphenyl)-hydroxymethyl]pyrrolidin-2-one (CID 24815206) is (5S)-5-[bis(3,5-dipropylphenyl)-hydroxymethyl]pyrrolidin-2-one.
What is the SMILES notation for (5S)-5-[bis(3,5-dipropylphenyl)-hydroxymethyl]pyrrolidin-2-one?
The canonical SMILES for (5S)-5-[bis(3,5-dipropylphenyl)-hydroxymethyl]pyrrolidin-2-one is CCCc1cc(CCC)cc(C(O)(c2cc(CCC)cc(CCC)c2)[C@@H]2CCC(=O)N2)c1.
What is the InChIKey of (5S)-5-[bis(3,5-dipropylphenyl)-hydroxymethyl]pyrrolidin-2-one?
The InChIKey is YNAQEZUNHSHNHA-MHZLTWQESA-N. The full InChI is InChI=1S/C29H41NO2/c1-5-9-21-15-22(10-6-2)18-25(17-21)29(32,27-13-14-28(31)30-27)26-19-23(11-7-3)16-24(20-26)12-8-4/h15-20,27,32H,5-14H2,1-4H3,(H,30,31)/t27-/m0/s1.
What are the key properties of (5S)-5-[bis(3,5-dipropylphenyl)-hydroxymethyl]pyrrolidin-2-one?
(5S)-5-[bis(3,5-dipropylphenyl)-hydroxymethyl]pyrrolidin-2-one has a molecular weight of 435.65 g/mol, XLogP of 6.01, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-[bis(3,5-dipropylphenyl)-hydroxymethyl]pyrrolidin-2-one is sourced from PubChem (CID 24815206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).