About N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene
N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene (PubChem CID 143342745) has the molecular formula C16H31NO
and a molecular weight of 253.43 g/mol. Its IUPAC name is N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene.
Molecular Properties
| Compound Name | N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene |
| PubChem CID | 143342745 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene |
| SMILES | CC.CC(=O)N(C)C.CCCC1=CCC=CCC1 |
| InChI | InChI=1S/C10H16.C4H9NO.C2H6/c1-2-7-10-8-5-3-4-6-9-10;1-4(6)5(2)3;1-2/h3-4,8H,2,5-7,9H2,1H3;1-3H3;1-2H3 |
| InChIKey | GRZZIGPOURWSAV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene?
The IUPAC name of N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene (CID 143342745) is N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene.
What is the SMILES notation for N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene?
The canonical SMILES for N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene is CC.CC(=O)N(C)C.CCCC1=CCC=CCC1.
What is the InChIKey of N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene?
The InChIKey is GRZZIGPOURWSAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C4H9NO.C2H6/c1-2-7-10-8-5-3-4-6-9-10;1-4(6)5(2)3;1-2/h3-4,8H,2,5-7,9H2,1H3;1-3H3;1-2H3.
What are the key properties of N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene?
N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene has a molecular weight of 253.43 g/mol, XLogP of 4.57, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene is sourced from PubChem (CID 143342745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).