C16H31NO — CID 143342745
N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene (PubChem CID 143342745) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene.
| Compound Name | N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene |
|---|---|
| PubChem CID | 143342745 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | N,N-dimethylacetamide;ethane;1-propylcyclohepta-1,4-diene |
| SMILES | CC.CC(=O)N(C)C.CCCC1=CCC=CCC1 |
| InChI | InChI=1S/C10H16.C4H9NO.C2H6/c1-2-7-10-8-5-3-4-6-9-10;1-4(6)5(2)3;1-2/h3-4,8H,2,5-7,9H2,1H3;1-3H3;1-2H3 |
| InChIKey | GRZZIGPOURWSAV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|