About 3-cyclohexa-1,4-dien-1-ylpropanoic acid
3-cyclohexa-1,4-dien-1-ylpropanoic acid (PubChem CID 10986432) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 3-cyclohexa-1,4-dien-1-ylpropanoic acid.
Molecular Properties
| Compound Name | 3-cyclohexa-1,4-dien-1-ylpropanoic acid |
| PubChem CID | 10986432 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 3-cyclohexa-1,4-dien-1-ylpropanoic acid |
| SMILES | O=C(O)CCC1=CCC=CC1 |
| InChI | InChI=1S/C9H12O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-2,5H,3-4,6-7H2,(H,10,11) |
| InChIKey | UPHVKZUAPKEZBV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexa-1,4-dien-1-ylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-1,4-dien-1-ylpropanoic acid?
The IUPAC name of 3-cyclohexa-1,4-dien-1-ylpropanoic acid (CID 10986432) is 3-cyclohexa-1,4-dien-1-ylpropanoic acid.
What is the SMILES notation for 3-cyclohexa-1,4-dien-1-ylpropanoic acid?
The canonical SMILES for 3-cyclohexa-1,4-dien-1-ylpropanoic acid is O=C(O)CCC1=CCC=CC1.
What is the InChIKey of 3-cyclohexa-1,4-dien-1-ylpropanoic acid?
The InChIKey is UPHVKZUAPKEZBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-2,5H,3-4,6-7H2,(H,10,11).
What are the key properties of 3-cyclohexa-1,4-dien-1-ylpropanoic acid?
3-cyclohexa-1,4-dien-1-ylpropanoic acid has a molecular weight of 152.19 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-1,4-dien-1-ylpropanoic acid is sourced from PubChem (CID 10986432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).