C39H50N2O2S — CID 130468479
4-cyclohexa-1,4-dien-1-yl-N-[(1S,2S)-1,2-diphenyl-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfinylamino]ethyl]butanamide (PubChem CID 130468479) has the molecular formula C39H50N2O2S and a molecular weight of 610.91 g/mol. Its IUPAC name is 4-cyclohexa-1,4-dien-1-yl-N-[(1S,2S)-1,2-diphenyl-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfinylamino]ethyl]butanamide.
| Compound Name | 4-cyclohexa-1,4-dien-1-yl-N-[(1S,2S)-1,2-diphenyl-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfinylamino]ethyl]butanamide |
|---|---|
| PubChem CID | 130468479 |
| Molecular Formula | C39H50N2O2S |
| Molecular Weight | 610.91 g/mol |
| Exact Mass | 610.36 |
| IUPAC Name | 4-cyclohexa-1,4-dien-1-yl-N-[(1S,2S)-1,2-diphenyl-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfinylamino]ethyl]butanamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)N[C@@H](c2ccccc2)[C@@H](NC(=O)CCCC2=CCC=CC2)c2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C39H50N2O2S/c1-27(2)33-25-34(28(3)4)39(35(26-33)29(5)6)44(43)41-38(32-22-14-9-15-23-32)37(31-20-12-8-13-21-31)40-36(42)24-16-19-30-17-10-7-11-18-30/h7-10,12-15,18,20-23,25-29,37-38,41H,11,16-17,19,24H2,1-6H3,(H,40,42)/t37-,38-,44?/m0/s1 |
| InChIKey | GHPMNRAZMNQNQW-YKRQQQBOSA-N |
| XLogP | 9.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.91 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|