C39H52N2O2S — CID 153496186
N-[2-(4-cyclohexa-1,3-dien-1-ylbutylamino)-1,2-diphenylethyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide (PubChem CID 153496186) has the molecular formula C39H52N2O2S and a molecular weight of 612.92 g/mol. Its IUPAC name is N-[2-(4-cyclohexa-1,3-dien-1-ylbutylamino)-1,2-diphenylethyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide.
| Compound Name | N-[2-(4-cyclohexa-1,3-dien-1-ylbutylamino)-1,2-diphenylethyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 153496186 |
| Molecular Formula | C39H52N2O2S |
| Molecular Weight | 612.92 g/mol |
| Exact Mass | 612.37 |
| IUPAC Name | N-[2-(4-cyclohexa-1,3-dien-1-ylbutylamino)-1,2-diphenylethyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)NC(c2ccccc2)C(NCCCCC2=CC=CCC2)c2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C39H52N2O2S/c1-28(2)34-26-35(29(3)4)39(36(27-34)30(5)6)44(42,43)41-38(33-23-14-9-15-24-33)37(32-21-12-8-13-22-32)40-25-17-16-20-31-18-10-7-11-19-31/h7-10,12-15,18,21-24,26-30,37-38,40-41H,11,16-17,19-20,25H2,1-6H3 |
| InChIKey | KCQGDGBNUGQCHN-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.92 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|