C31H36N2O2S — CID 150853992
N-[(1S,2S)-2-[4-(5-methylcyclohexa-1,4-dien-1-yl)butylamino]-1,2-diphenylethyl]benzenesulfonamide (PubChem CID 150853992) has the molecular formula C31H36N2O2S and a molecular weight of 500.71 g/mol. Its IUPAC name is N-[(1S,2S)-2-[4-(5-methylcyclohexa-1,4-dien-1-yl)butylamino]-1,2-diphenylethyl]benzenesulfonamide.
| Compound Name | N-[(1S,2S)-2-[4-(5-methylcyclohexa-1,4-dien-1-yl)butylamino]-1,2-diphenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 150853992 |
| Molecular Formula | C31H36N2O2S |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | N-[(1S,2S)-2-[4-(5-methylcyclohexa-1,4-dien-1-yl)butylamino]-1,2-diphenylethyl]benzenesulfonamide |
| SMILES | CC1=CCC=C(CCCCN[C@@H](c2ccccc2)[C@@H](NS(=O)(=O)c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C31H36N2O2S/c1-25-14-13-16-26(24-25)15-11-12-23-32-30(27-17-5-2-6-18-27)31(28-19-7-3-8-20-28)33-36(34,35)29-21-9-4-10-22-29/h2-10,14,16-22,30-33H,11-13,15,23-24H2,1H3/t30-,31-/m0/s1 |
| InChIKey | KQPSBXVWNJDEHO-CONSDPRKSA-N |
| XLogP | 6.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|