C36H40N2O3S — CID 118434134
N-[(1R,2S)-2-[3-(4-hex-5-ynoxyphenyl)propylamino]-1,2-diphenylethyl]-4-methylbenzenesulfonamide (PubChem CID 118434134) has the molecular formula C36H40N2O3S and a molecular weight of 580.79 g/mol. Its IUPAC name is N-[(1R,2S)-2-[3-(4-hex-5-ynoxyphenyl)propylamino]-1,2-diphenylethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R,2S)-2-[3-(4-hex-5-ynoxyphenyl)propylamino]-1,2-diphenylethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 118434134 |
| Molecular Formula | C36H40N2O3S |
| Molecular Weight | 580.79 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | N-[(1R,2S)-2-[3-(4-hex-5-ynoxyphenyl)propylamino]-1,2-diphenylethyl]-4-methylbenzenesulfonamide |
| SMILES | C#CCCCCOc1ccc(CCCN[C@@H](c2ccccc2)[C@H](NS(=O)(=O)c2ccc(C)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H40N2O3S/c1-3-4-5-12-28-41-33-23-21-30(22-24-33)14-13-27-37-35(31-15-8-6-9-16-31)36(32-17-10-7-11-18-32)38-42(39,40)34-25-19-29(2)20-26-34/h1,6-11,15-26,35-38H,4-5,12-14,27-28H2,2H3/t35-,36+/m0/s1 |
| InChIKey | DNJSIIBZEBNLSY-MPQUPPDSSA-N |
| XLogP | 7.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.79 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|