C32H36N2O4S — CID 90152510
N-[(1R,2R)-2-[3-(3,5-dimethoxyphenyl)propylamino]-1,2-diphenylethyl]-4-methylbenzenesulfonamide (PubChem CID 90152510) has the molecular formula C32H36N2O4S and a molecular weight of 544.72 g/mol. Its IUPAC name is N-[(1R,2R)-2-[3-(3,5-dimethoxyphenyl)propylamino]-1,2-diphenylethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-[3-(3,5-dimethoxyphenyl)propylamino]-1,2-diphenylethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 90152510 |
| Molecular Formula | C32H36N2O4S |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | N-[(1R,2R)-2-[3-(3,5-dimethoxyphenyl)propylamino]-1,2-diphenylethyl]-4-methylbenzenesulfonamide |
| SMILES | COc1cc(CCCN[C@H](c2ccccc2)[C@H](NS(=O)(=O)c2ccc(C)cc2)c2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C32H36N2O4S/c1-24-16-18-30(19-17-24)39(35,36)34-32(27-14-8-5-9-15-27)31(26-12-6-4-7-13-26)33-20-10-11-25-21-28(37-2)23-29(22-25)38-3/h4-9,12-19,21-23,31-34H,10-11,20H2,1-3H3/t31-,32-/m1/s1 |
| InChIKey | VAUXIYWUUGYFCQ-ROJLCIKYSA-N |
| XLogP | 6.00 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|