C31H36N2O3S — CID 153496176
4-methyl-N-[2-[2-[(4-methylcyclohexa-1,3-dien-1-yl)methoxy]ethylamino]-1,2-diphenylethyl]benzenesulfonamide (PubChem CID 153496176) has the molecular formula C31H36N2O3S and a molecular weight of 516.71 g/mol. Its IUPAC name is 4-methyl-N-[2-[2-[(4-methylcyclohexa-1,3-dien-1-yl)methoxy]ethylamino]-1,2-diphenylethyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-[2-[(4-methylcyclohexa-1,3-dien-1-yl)methoxy]ethylamino]-1,2-diphenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 153496176 |
| Molecular Formula | C31H36N2O3S |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 4-methyl-N-[2-[2-[(4-methylcyclohexa-1,3-dien-1-yl)methoxy]ethylamino]-1,2-diphenylethyl]benzenesulfonamide |
| SMILES | CC1=CC=C(COCCNC(c2ccccc2)C(NS(=O)(=O)c2ccc(C)cc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C31H36N2O3S/c1-24-13-17-26(18-14-24)23-36-22-21-32-30(27-9-5-3-6-10-27)31(28-11-7-4-8-12-28)33-37(34,35)29-19-15-25(2)16-20-29/h3-13,15-17,19-20,30-33H,14,18,21-23H2,1-2H3 |
| InChIKey | JUHVBHKIIMEZNO-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|