C31H36ClN2O3RuS+ — CID 153496191
carbanide;chlororuthenium(3+);[2-[2-(cyclohexa-1,3-dien-1-ylmethoxy)ethylamino]-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide (PubChem CID 153496191) has the molecular formula C31H36ClN2O3RuS+ and a molecular weight of 653.23 g/mol. Its IUPAC name is carbanide;chlororuthenium(3+);[2-[2-(cyclohexa-1,3-dien-1-ylmethoxy)ethylamino]-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide.
| Compound Name | carbanide;chlororuthenium(3+);[2-[2-(cyclohexa-1,3-dien-1-ylmethoxy)ethylamino]-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide |
|---|---|
| PubChem CID | 153496191 |
| Molecular Formula | C31H36ClN2O3RuS+ |
| Molecular Weight | 653.23 g/mol |
| Exact Mass | 653.12 |
| IUPAC Name | carbanide;chlororuthenium(3+);[2-[2-(cyclohexa-1,3-dien-1-ylmethoxy)ethylamino]-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide |
| SMILES | Cc1ccc(S(=O)(=O)[N-]C(c2ccccc2)C(NCCOCC2=CC=CCC2)c2ccccc2)cc1.Cl[Ru+3].[CH3-] |
| InChI | InChI=1S/C30H33N2O3S.CH3.ClH.Ru/c1-24-17-19-28(20-18-24)36(33,34)32-30(27-15-9-4-10-16-27)29(26-13-7-3-8-14-26)31-21-22-35-23-25-11-5-2-6-12-25;;;/h2-5,7-11,13-20,29-31H,6,12,21-23H2,1H3;1H3;1H;/q2*-1;;+4/p-1 |
| InChIKey | UYNKUXAYZXQYIL-UHFFFAOYSA-M |
| XLogP | 7.56 |
| TPSA | 69.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.23 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|