C25H29ClN2O3RuS+2 — CID 175808333
1-chloro-N-[(1R,2R)-2-[2-[(4-methylphenyl)methoxy]ethylamino]-1,2-diphenylethyl]methanesulfonamide;ruthenium(2+) (PubChem CID 175808333) has the molecular formula C25H29ClN2O3RuS+2 and a molecular weight of 574.11 g/mol. Its IUPAC name is 1-chloro-N-[(1R,2R)-2-[2-[(4-methylphenyl)methoxy]ethylamino]-1,2-diphenylethyl]methanesulfonamide;ruthenium(2+).
| Compound Name | 1-chloro-N-[(1R,2R)-2-[2-[(4-methylphenyl)methoxy]ethylamino]-1,2-diphenylethyl]methanesulfonamide;ruthenium(2+) |
|---|---|
| PubChem CID | 175808333 |
| Molecular Formula | C25H29ClN2O3RuS+2 |
| Molecular Weight | 574.11 g/mol |
| Exact Mass | 574.06 |
| IUPAC Name | 1-chloro-N-[(1R,2R)-2-[2-[(4-methylphenyl)methoxy]ethylamino]-1,2-diphenylethyl]methanesulfonamide;ruthenium(2+) |
| SMILES | Cc1ccc(COCCN[C@H](c2ccccc2)[C@H](NS(=O)(=O)CCl)c2ccccc2)cc1.[Ru+2] |
| InChI | InChI=1S/C25H29ClN2O3S.Ru/c1-20-12-14-21(15-13-20)18-31-17-16-27-24(22-8-4-2-5-9-22)25(28-32(29,30)19-26)23-10-6-3-7-11-23;/h2-15,24-25,27-28H,16-19H2,1H3;/q;+2/t24-,25-;/m1./s1 |
| InChIKey | MATUIGFHMCDHES-JIMLSGQQSA-N |
| XLogP | 4.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.11 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|