C30H37ClN2O2RuS — CID 172764505
chlororuthenium(1+);[2-(3-cyclohexylpropylamino)-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide (PubChem CID 172764505) has the molecular formula C30H37ClN2O2RuS and a molecular weight of 626.23 g/mol. Its IUPAC name is chlororuthenium(1+);[2-(3-cyclohexylpropylamino)-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide.
| Compound Name | chlororuthenium(1+);[2-(3-cyclohexylpropylamino)-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide |
|---|---|
| PubChem CID | 172764505 |
| Molecular Formula | C30H37ClN2O2RuS |
| Molecular Weight | 626.23 g/mol |
| Exact Mass | 626.13 |
| IUPAC Name | chlororuthenium(1+);[2-(3-cyclohexylpropylamino)-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide |
| SMILES | Cc1ccc(S(=O)(=O)[N-]C(c2ccccc2)C(NCCCC2CCCCC2)c2ccccc2)cc1.Cl[Ru+] |
| InChI | InChI=1S/C30H37N2O2S.ClH.Ru/c1-24-19-21-28(22-20-24)35(33,34)32-30(27-17-9-4-10-18-27)29(26-15-7-3-8-16-26)31-23-11-14-25-12-5-2-6-13-25;;/h3-4,7-10,15-22,25,29-31H,2,5-6,11-14,23H2,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | KNMNNHIJMVWEDG-UHFFFAOYSA-M |
| XLogP | 8.18 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.23 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|